|
CAS#: 37169-10-1 Product: (2,4-Dichloro-6-Nitrophenyl) Acetate No suppilers available for the product. |
| Name | (2,4-Dichloro-6-Nitrophenyl) Acetate |
|---|---|
| Synonyms | (2,4-Dichloro-6-Nitro-Phenyl) Acetate; Acetic Acid (2,4-Dichloro-6-Nitrophenyl) Ester; Acetic Acid (2,4-Dichloro-6-Nitro-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl2NO4 |
| Molecular Weight | 250.04 |
| CAS Registry Number | 37169-10-1 |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])OC(C)=O)Cl)Cl |
| InChI | 1S/C8H5Cl2NO4/c1-4(12)15-8-6(10)2-5(9)3-7(8)11(13)14/h2-3H,1H3 |
| InChIKey | XVJWRWTVEVZQGG-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.192°C at 760 mmHg (Cal.) |
| Flash point | 155.309°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4-Dichloro-6-Nitrophenyl) Acetate |