|
CAS#: 37224-61-6 Product: 4-(6-Methylheptyl)-3,5-Dinitrophenol No suppilers available for the product. |
| Name | 4-(6-Methylheptyl)-3,5-Dinitrophenol |
|---|---|
| Synonyms | isooctyldinitrophenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 37224-61-6 |
| EINECS | 253-410-9 |
| SMILES | O=N(=O)c1cc(O)cc(c1CCCCCC(C)C)N(=O)=O |
| InChI | 1S/C14H20N2O5/c1-10(2)6-4-3-5-7-12-13(15(18)19)8-11(17)9-14(12)16(20)21/h8-10,17H,3-7H2,1-2H3 |
| InChIKey | LZHVTZNVSMHVQV-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.036°C at 760 mmHg (Cal.) |
| Flash point | 162.841°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(6-Methylheptyl)-3,5-Dinitrophenol |