|
CAS#: 37260-14-3 Product: (1,1-Dimethylethyl)ethenyl-Benzene polymer with ethenylbenzene No suppilers available for the product. |
| Name | (1,1-Dimethylethyl)ethenyl-Benzene polymer with ethenylbenzene |
|---|---|
| Synonyms | 1-Tert-Butyl-2-Vinyl-Benzene; Styrene; 1-Tert-Butyl-2-Vinylbenzene; Styrene; 1-Tert-Butyl-2-Ethenyl-Benzene; Ethenylbenzene |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 |
| CAS Registry Number | 37260-14-3 |
| SMILES | C1=C(C(C)(C)C)C(=CC=C1)C=C.C2=C(C=CC=C2)C=C |
| InChI | 1S/C12H16.C8H8/c1-5-10-8-6-7-9-11(10)12(2,3)4;1-2-8-6-4-3-5-7-8/h5-9H,1H2,2-4H3;2-7H,1H2 |
| InChIKey | GDQUFDOBWXWLSN-UHFFFAOYSA-N |
| Boiling point | 210.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 74.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,1-Dimethylethyl)ethenyl-Benzene polymer with ethenylbenzene |