|
CAS#: 3732-90-9 Product: N,N,2-Trimethyl-4-Phenyldiazenylaniline No suppilers available for the product. |
| Name | N,N,2-Trimethyl-4-Phenyldiazenylaniline |
|---|---|
| Synonyms | N,N,2-Trimethyl-4-Phenylazo-Aniline; N,N,2-Trimethyl-4-Phenylazoaniline; Dimethyl-(2-Methyl-4-Phenylazo-Phenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 |
| CAS Registry Number | 3732-90-9 |
| SMILES | C1=CC(=CC(=C1N(C)C)C)N=NC2=CC=CC=C2 |
| InChI | 1S/C15H17N3/c1-12-11-14(9-10-15(12)18(2)3)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | FMDTUZFOCQKSFX-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.688°C at 760 mmHg (Cal.) |
| Flash point | 188.267°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,2-Trimethyl-4-Phenyldiazenylaniline |