|
CAS#: 37339-58-5 Product: ornithine alpha-ketoglutarate No suppilers available for the product. |
| Name | ornithine alpha-ketoglutarate |
|---|---|
| Synonyms | (2R)-2,5-Diaminovaleric Acid; 2-Ketoglutaric Acid; Cetornan; Di-L-Ornithine-Alpha-Ketoglutarate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O7 |
| Molecular Weight | 278.26 |
| CAS Registry Number | 37339-58-5 |
| SMILES | [C@H](N)(C(=O)O)CCCN.C(C(=O)C(=O)O)CC(=O)O |
| InChI | 1S/C5H12N2O2.C5H6O5/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);1-2H2,(H,7,8)(H,9,10)/t4-;/m1./s1 |
| InChIKey | SLPUVFBNQHVEEU-PGMHMLKASA-N |
| Boiling point | 345.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ornithine alpha-ketoglutarate |