|
CAS#: 373390-48-8 Product: 5-{(Z)-[(2-Hydroxyethyl)Imino]Methyl}-1,2,3,4-Benzenetetrol No suppilers available for the product. |
| Name | 5-{(Z)-[(2-Hydroxyethyl)Imino]Methyl}-1,2,3,4-Benzenetetrol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 373390-48-8 |
| SMILES | c1c(c(c(c(c1O)O)O)O)/C=N\CCO |
| InChI | 1S/C9H11NO5/c11-2-1-10-4-5-3-6(12)8(14)9(15)7(5)13/h3-4,11-15H,1-2H2/b10-4- |
| InChIKey | VQKWEPDHJRKYSY-WMZJFQQLSA-N |
| Density | 1.522g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.453°C at 760 mmHg (Cal.) |
| Flash point | 358.969°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-{(Z)-[(2-Hydroxyethyl)Imino]Methyl}-1,2,3,4-Benzenetetrol |