|
CAS#: 3735-80-6 Product: 8-Methoxy-7,9-Dioxa-8-Phosphabicyclo[4.4.0]Deca-1,3,5-Triene 8-Oxide No suppilers available for the product. |
| Name | 8-Methoxy-7,9-Dioxa-8-Phosphabicyclo[4.4.0]Deca-1,3,5-Triene 8-Oxide |
|---|---|
| Synonyms | 2-Methoxy-4H-1,3,2-Benzodioxaphosphorin 2-Oxide; 4H-1,3,2-Benzodioxaphosphorin, 2-Methoxy-, 2-Oxide (9Ci); Ai3-27203 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9O4P |
| Molecular Weight | 200.13 |
| CAS Registry Number | 3735-80-6 |
| SMILES | C2=C1O[P](OCC1=CC=C2)(OC)=O |
| InChI | 1S/C8H9O4P/c1-10-13(9)11-6-7-4-2-3-5-8(7)12-13/h2-5H,6H2,1H3 |
| InChIKey | OIULAULHYHSZIN-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.389°C at 760 mmHg (Cal.) |
| Flash point | 120.508°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-7,9-Dioxa-8-Phosphabicyclo[4.4.0]Deca-1,3,5-Triene 8-Oxide |