Online Database of Chemicals from Around the World
|
CAS#: 3738-01-0 Product: (7S,8R,9R)-9-(1,3-Benzodioxol-5-Yl)-7,8-Dimethyl-6,7,8,9-Tetrahydrobenzo[g][1,3]Benzodioxole No suppilers available for the product. |
| Name | (7S,8R,9R)-9-(1,3-Benzodioxol-5-Yl)-7,8-Dimethyl-6,7,8,9-Tetrahydrobenzo[g][1,3]Benzodioxole |
|---|---|
| Synonyms | C10728; Otobain |
| Molecular Structure | ![CAS#: 3738-01-0, (7S,8R,9R)-9-(1,3-Benzodioxol-5-Yl)-7,8-Dimethyl-6,7,8,9-Tetrahydrobenzo[g][1,3]Benzodioxole](/moreStructures/3738-01-0.gif) |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 |
| CAS Registry Number | 3738-01-0 |
| SMILES | [C@H]1(C2=C(C[C@H](C)[C@H]1C)C=CC3=C2OCO3)C5=CC=C4OCOC4=C5 |
| InChI | 1S/C20H20O4/c1-11-7-13-4-6-16-20(24-10-22-16)19(13)18(12(11)2)14-3-5-15-17(8-14)23-9-21-15/h3-6,8,11-12,18H,7,9-10H2,1-2H3/t11-,12+,18+/m0/s1 |
| InChIKey | HTUIKPYRGODLDO-VNBZBWLYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 133.8±35.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (7S,8R,9R)-9-(1,3-Benzodioxol-5-Yl)-7,8-Dimethyl-6,7,8,9-Tetrahydrobenzo[g][1,3]Benzodioxole |