|
CAS#: 3741-90-0 Product: N-Phenyl-N-(1-Phenylethylideneamino)Aniline No suppilers available for the product. |
| Name | N-Phenyl-N-(1-Phenylethylideneamino)Aniline |
|---|---|
| Synonyms | Di(Phenyl)-(1-Phenylethylideneamino)Amine; Zinc05003297; Ethanone, 1-Phenyl-, Diphenylhydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 |
| CAS Registry Number | 3741-90-0 |
| SMILES | C3=C(N(\N=C(C1=CC=CC=C1)\C)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C20H18N2/c1-17(18-11-5-2-6-12-18)21-22(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3/b21-17- |
| InChIKey | AGBSHMKRSVRCNP-FXBPSFAMSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.116°C at 760 mmHg (Cal.) |
| Flash point | 208.484°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-N-(1-Phenylethylideneamino)Aniline |