|
CAS#: 3743-91-7 Product: N-(4-Acetamido-2,6-Difluorophenyl)Acetamide No suppilers available for the product. |
| Name | N-(4-Acetamido-2,6-Difluorophenyl)Acetamide |
|---|---|
| Synonyms | N-(4-Acetamido-2,6-Difluoro-Phenyl)Acetamide; N-(4-Acetamido-2,6-Difluoro-Phenyl)Ethanamide; Nsc81296 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 |
| CAS Registry Number | 3743-91-7 |
| SMILES | C1=C(F)C(=C(F)C=C1NC(=O)C)NC(=O)C |
| InChI | 1S/C10H10F2N2O2/c1-5(15)13-7-3-8(11)10(9(12)4-7)14-6(2)16/h3-4H,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | WCMDJYLRUUMHDE-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.016°C at 760 mmHg (Cal.) |
| Flash point | 203.585°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Acetamido-2,6-Difluorophenyl)Acetamide |