|
CAS#: 37467-65-5 Product: 1-(3,5-Diethyl-2,6-Dihydroxyphenyl)Ethanone No suppilers available for the product. |
| Name | 1-(3,5-Diethyl-2,6-Dihydroxyphenyl)Ethanone |
|---|---|
| Synonyms | 1-(3,5-Diethyl-2,6-Dihydroxy-Phenyl)Ethanone; 1-(3,5-Diethyl-2,6-Dihydroxyphenyl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 37467-65-5 |
| EINECS | 253-516-5 |
| SMILES | C1=C(C(=C(C(=C1CC)O)C(=O)C)O)CC |
| InChI | 1S/C12H16O3/c1-4-8-6-9(5-2)12(15)10(7(3)13)11(8)14/h6,14-15H,4-5H2,1-3H3 |
| InChIKey | NAIUVEYPIKQZIB-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.139°C at 760 mmHg (Cal.) |
| Flash point | 173.712°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,5-Diethyl-2,6-Dihydroxyphenyl)Ethanone |