|
CAS#: 37496-00-7 Product: 4,5-Epoxy-4,5-dihydropyrene No suppilers available for the product. |
| Name | 4,5-Epoxy-4,5-dihydropyrene |
|---|---|
| Synonyms | 8B,9A-Dihydropyreno(4,5-B)Oxirene; Brn 1347050; Ccris 3847 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 |
| CAS Registry Number | 37496-00-7 |
| SMILES | C2=C1C=CC=C4C1=C3C(=C2)C=CC=C3C5C4O5 |
| InChI | 1S/C16H10O/c1-3-9-7-8-10-4-2-6-12-14(10)13(9)11(5-1)15-16(12)17-15/h1-8,15-16H |
| InChIKey | RJCXKHSGIOKCID-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.637°C at 760 mmHg (Cal.) |
| Flash point | 202.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Epoxy-4,5-dihydropyrene |