Online Database of Chemicals from Around the World
| Name | 1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentane-1-Sulfonyl Fluoride |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-1-Pentanesulfonyl Fluoride; 1-Pentanesulfonyl Fluoride, 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro- |
| Molecular Structure |  |
| Molecular Formula | C5F12O2S |
| Molecular Weight | 352.09 |
| CAS Registry Number | 375-81-5 |
| EINECS | 206-795-2 |
| SMILES | O=[S](F)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C5F12O2S/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)20(17,18)19 |
| InChIKey | USAIUDWRPJQRTG-UHFFFAOYSA-N |
| Density | 1.781g/cm3 (Cal.) |
|---|---|
| Boiling point | 89.9°C at 760 mmHg (Cal.) |
| Flash point | 8.171°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentane-1-Sulfonyl Fluoride |
