|
CAS#: 37550-69-9 Product: Methyl 1,3,6,9B-Tetraazaphenalene-4-Carboxylate No suppilers available for the product. |
| Name | Methyl 1,3,6,9B-Tetraazaphenalene-4-Carboxylate |
|---|---|
| Synonyms | Methyl 1,3,6,9b-tetraazaphenalene-4-carboxylate # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 |
| CAS Registry Number | 37550-69-9 |
| SMILES | O=C(OC)\C\1=C3/N=C\N=C2\C=C/C=C(/N=C/1)N23 |
| InChI | 1S/C11H8N4O2/c1-17-11(16)7-5-12-8-3-2-4-9-13-6-14-10(7)15(8)9/h2-6H,1H3 |
| InChIKey | NCJGITJMRDMFLM-UHFFFAOYSA-N |
| Density | 1.501g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.676°C at 760 mmHg (Cal.) |
| Flash point | 177.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1,3,6,9B-Tetraazaphenalene-4-Carboxylate |