|
CAS#: 376-77-2 Product: 1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane |
|---|---|
| Synonyms | Cyclopentane, Decafluoro-; Decafluorocyclopentane |
| Molecular Structure | ![]() |
| Molecular Formula | C5F10 |
| Molecular Weight | 250.04 |
| CAS Registry Number | 376-77-2 |
| EINECS | 206-814-4 |
| SMILES | FC1(F)C(F)(F)C(C(C1(F)F)(F)F)(F)F |
| InChI | 1S/C5F10/c6-1(7)2(8,9)4(12,13)5(14,15)3(1,10)11 |
| InChIKey | PWMJXZJISGDARB-UHFFFAOYSA-N |
| Density | 1.699g/cm3 (Cal.) |
|---|---|
| Boiling point | 26.426°C at 760 mmHg (Cal.) |
| Flash point | -21.155°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane |