|
CAS#: 37609-41-9 Product: 3-[(2-Methyl-2-Propanyl)Oxy]Bicyclo[3.2.1]Oct-2-Ene No suppilers available for the product. |
| Name | 3-[(2-Methyl-2-Propanyl)Oxy]Bicyclo[3.2.1]Oct-2-Ene |
|---|---|
| Synonyms | Bicyclo[3.2.1]oct-2-en-3-yl tert-butyl ether # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 37609-41-9 |
| SMILES | O(/C1=C/C2CC(C1)CC2)C(C)(C)C |
| InChI | 1S/C12H20O/c1-12(2,3)13-11-7-9-4-5-10(6-9)8-11/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | QGXDKNRZDGKFCG-UHFFFAOYSA-N |
| Density | 0.947g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.748°C at 760 mmHg (Cal.) |
| Flash point | 101.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(2-Methyl-2-Propanyl)Oxy]Bicyclo[3.2.1]Oct-2-Ene |