Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | Ethyl 3-[2-Fluoro-6-(Trifluoromethyl)Phenyl]Propanoate |
|---|---|
| Synonyms | 3-(2-Fluoro-6-trifluoromethyl-phenyl)-propionic ac; BENZENEPR |
| Molecular Structure | ![CAS#: 376641-10-0, Ethyl 3-[2-Fluoro-6-(Trifluoromethyl)Phenyl]Propanoate](/moreStructures/376641-10-0.gif) |
| Molecular Formula | C12H12F4O2 |
| Molecular Weight | 264.22 |
| CAS Registry Number | 376641-10-0 |
| SMILES | Fc1cccc(c1CCC(=O)OCC)C(F)(F)F |
| InChI | 1S/C12H12F4O2/c1-2-18-11(17)7-6-8-9(12(14,15)16)4-3-5-10(8)13/h3-5H,2,6-7H2,1H3 |
| InChIKey | ACGYYVNOBYFDTI-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.511°C at 760 mmHg (Cal.) |
| Flash point | 99.949°C (Cal.) |
| Refractive index | 1.443 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-[2-Fluoro-6-(Trifluoromethyl)Phenyl]Propanoate |