| Name | 1,2,3,4,5,5,6,6-Octafluoro-1,3-Cyclohexadiene |
|---|---|
| Synonyms | 1,2,3,4,5,5,6,6-Octafluoro-1,3-cyclohexadiene #; octafluorobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C6F8 |
| Molecular Weight | 224.05 |
| CAS Registry Number | 377-70-8 |
| SMILES | C1(=C(C(C(C(=C1F)F)(F)F)(F)F)F)F |
| InChI | 1S/C6F8/c7-1-2(8)4(10)6(13,14)5(11,12)3(1)9 |
| InChIKey | NYEZNHLGLOQHEE-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 89.2±40.0°C at 760 mmHg (Cal.) |
| Flash point | 7.8±19.1°C (Cal.) |
| (1) | Stuart Batterman, Chunrong Jia, Gina Hatzivasilis and Chris Godwin. Simultaneous measurement of ventilation using tracer gas techniques and VOC concentrations in homes, garages and vehicles, J. Environ. Monit., 2006, 8, 249. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,5,6,6-Octafluoro-1,3-Cyclohexadiene |