|
CAS#: 37733-64-5 Product: 6-Methoxy-3-Methyl-2-[(E)-2-Nitroethenyl]-1-Benzofuran No suppilers available for the product. |
| Name | 6-Methoxy-3-Methyl-2-[(E)-2-Nitroethenyl]-1-Benzofuran |
|---|---|
| Synonyms | 6-Methoxy-3-Methyl-2-[(E)-2-Nitrovinyl]Benzofuran; (Nitro-2 Vinyl)-2 Methyl-3 Methoxy-6 Benzofuranne [French]; 6-Methoxy-3-Methyl-2-(2-Nitroethenyl)Benzofuran |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 |
| CAS Registry Number | 37733-64-5 |
| SMILES | C2=C1OC(=C(C1=CC=C2OC)C)\C=C\[N+]([O-])=O |
| InChI | 1S/C12H11NO4/c1-8-10-4-3-9(16-2)7-12(10)17-11(8)5-6-13(14)15/h3-7H,1-2H3/b6-5+ |
| InChIKey | VWACKKSWDPLSHA-AATRIKPKSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.734°C at 760 mmHg (Cal.) |
| Flash point | 182.852°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-3-Methyl-2-[(E)-2-Nitroethenyl]-1-Benzofuran |