Online Database of Chemicals from Around the World
|
CAS#: 3774-64-9 Product: 1,6-Dihydroxy-8-Methoxy-3-Methylanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,6-Dihydroxy-8-Methoxy-3-Methylanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,6-Dihydroxy-8-Methoxy-3-Methyl-Anthracene-9,10-Dione; 1,6-Dihydroxy-8-Methoxy-3-Methyl-9,10-Anthraquinone; C01448 |
| Molecular Structure |  |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 3774-64-9 |
| SMILES | C1=C(C2=C(C=C1O)C(C3=C(C2=O)C(=CC(=C3)C)O)=O)OC |
| InChI | 1S/C16H12O5/c1-7-3-9-13(11(18)4-7)16(20)14-10(15(9)19)5-8(17)6-12(14)21-2/h3-6,17-18H,1-2H3 |
| InChIKey | UUNPIWCQMVNINR-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.014°C at 760 mmHg (Cal.) |
| Flash point | 213.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dihydroxy-8-Methoxy-3-Methylanthracene-9,10-Dione |