| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | Potassium 2,2,3,3,3-Pentafluoropropanoate |
|---|---|
| Synonyms | Potassium 2,2,3,3,3-Pentafluoropropionate; Potassium Pentafluoropropionate |
| Molecular Structure | ![]() |
| Molecular Formula | C3F5KO2 |
| Molecular Weight | 202.12 |
| CAS Registry Number | 378-76-7 |
| EINECS | 206-829-6 |
| SMILES | O=C([O-])C(F)(F)C(F)(F)F.[K+] |
| InChI | 1S/C3HF5O2.K/c4-2(5,1(9)10)3(6,7)8;/h(H,9,10);/q;+1/p-1 |
| InChIKey | AHGFDQXBCIASJK-UHFFFAOYSA-M |
| Boiling point | 93.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 10.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2,2,3,3,3-Pentafluoropropanoate |