|
CAS#: 3785-20-4 Product: N-[2-Tert-Butyl-6-(Chloromethyl)Phenyl]Acetamide No suppilers available for the product. |
| Name | N-[2-Tert-Butyl-6-(Chloromethyl)Phenyl]Acetamide |
|---|---|
| Synonyms | N-[2-Tert-Butyl-6-(Chloromethyl)Phenyl]Ethanamide; 2-Tert-Butyl-6-Methylchloroacetanilide; Alpha-Chloro-6-(T-Butyl)-O-Acetotoluidide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.74 |
| CAS Registry Number | 3785-20-4 |
| SMILES | C1=CC=C(C(=C1C(C)(C)C)NC(C)=O)CCl |
| InChI | 1S/C13H18ClNO/c1-9(16)15-12-10(8-14)6-5-7-11(12)13(2,3)4/h5-7H,8H2,1-4H3,(H,15,16) |
| InChIKey | MSERLYJDTDEOIE-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.334°C at 760 mmHg (Cal.) |
| Flash point | 180.796°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-Tert-Butyl-6-(Chloromethyl)Phenyl]Acetamide |