|
CAS#: 37895-44-6 Product: 4-Methyl-5-Oxido-1,2,5-Oxadiazol-5-Ium-3-Carboxamide No suppilers available for the product. |
| Name | 4-Methyl-5-Oxido-1,2,5-Oxadiazol-5-Ium-3-Carboxamide |
|---|---|
| Synonyms | 4-Methyl-5-Oxido-Furazan-5-Ium-3-Carboxamide; Furazancarboxamide, 4-Methyl-, 5-Oxide; Nsc234494 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H5N3O3 |
| Molecular Weight | 143.10 |
| CAS Registry Number | 37895-44-6 |
| SMILES | CC1=[N+](ON=C1C(N)=O)[O-] |
| InChI | 1S/C4H5N3O3/c1-2-3(4(5)8)6-10-7(2)9/h1H3,(H2,5,8) |
| InChIKey | DKBVMDZYMTWNCN-UHFFFAOYSA-N |
| Density | 1.772g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.289°C at 760 mmHg (Cal.) |
| Flash point | 157.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-5-Oxido-1,2,5-Oxadiazol-5-Ium-3-Carboxamide |