|
CAS#: 37913-85-2 Product: [(E)-2-Chloro-1-(2,3,4-Trichlorophenyl)Ethenyl] Dimethyl Phosphate No suppilers available for the product. |
| Name | [(E)-2-Chloro-1-(2,3,4-Trichlorophenyl)Ethenyl] Dimethyl Phosphate |
|---|---|
| Synonyms | [(E)-2-Chloro-1-(2,3,4-Trichlorophenyl)Vinyl] Dimethyl Phosphate; Phosphoric Acid [(E)-2-Chloro-1-(2,3,4-Trichlorophenyl)Vinyl] Dimethyl Ester; 2-Chloro-1-(2,3,4-Trichlorophenyl)Vinyl Dimethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Cl4O4P |
| Molecular Weight | 365.96 |
| CAS Registry Number | 37913-85-2 |
| SMILES | C1=C(\C(O[P](OC)(OC)=O)=C/Cl)C(=C(Cl)C(=C1)Cl)Cl |
| InChI | 1S/C10H9Cl4O4P/c1-16-19(15,17-2)18-8(5-11)6-3-4-7(12)10(14)9(6)13/h3-5H,1-2H3/b8-5+ |
| InChIKey | CKRKMPZQCMAKGJ-VMPITWQZSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.144°C at 760 mmHg (Cal.) |
| Flash point | 307.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-2-Chloro-1-(2,3,4-Trichlorophenyl)Ethenyl] Dimethyl Phosphate |