|
CAS#: 37934-99-9 Product: 2,2,2-Trichloroethyl Benzoate No suppilers available for the product. |
| Name | 2,2,2-Trichloroethyl Benzoate |
|---|---|
| Synonyms | 2,2,2-Trichloroethyl benzoate; 2,2,2-Trichloroethyl benzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7Cl3O2 |
| Molecular Weight | 253.51 |
| CAS Registry Number | 37934-99-9 |
| SMILES | O=C(OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | 1S/C9H7Cl3O2/c10-9(11,12)6-14-8(13)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | WGXLSZQUOYSATB-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.994°C at 760 mmHg (Cal.) |
| Flash point | 128.123°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloroethyl Benzoate |