|
CAS#: 37939-80-3 Product: (NZ)-N-[(1R,4R)-1,7,7-Trimethyl-2-Bicyclo[2.2.1]Heptanylidene]Hydroxylamine No suppilers available for the product. |
| Name | (NZ)-N-[(1R,4R)-1,7,7-Trimethyl-2-Bicyclo[2.2.1]Heptanylidene]Hydroxylamine |
|---|---|
| Synonyms | (1R,4R)-1,7,7-Trimethylnorbornan-2-One Oxime; (1R,4R)-1,7,7-Trimethyl-2-Norbornanone Oxime; Zinc00090730 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 |
| CAS Registry Number | 37939-80-3 |
| EINECS | 253-725-1 |
| SMILES | [C@]\12(C([C@@H](CC1=N/O)CC2)(C)C)C |
| InChI | 1S/C10H17NO/c1-9(2)7-4-5-10(9,3)8(6-7)11-12/h7,12H,4-6H2,1-3H3/b11-8-/t7-,10+/m1/s1 |
| InChIKey | OVFDEGGJFJECAT-SMXKXMKRSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.983°C at 760 mmHg (Cal.) |
| Flash point | 136.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (NZ)-N-[(1R,4R)-1,7,7-Trimethyl-2-Bicyclo[2.2.1]Heptanylidene]Hydroxylamine |