| Name | (5E,9E,13E)-6,10,14,18-Tetramethylnonadeca-5,9,13,17-Tetraen-2-One |
|---|---|
| Synonyms | 6,10,14,18-Tetramethylnonadeca-5,9,13,17-Tetraen-2-One; Ea-0671; 5,9,13,17-Nonadecatetraen-2-One, 6,10,14,18-Tetramethyl-, (E,E,E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.55 |
| CAS Registry Number | 3796-63-2 |
| SMILES | C(\C(=C\CC\C(=C\CCC(=O)C)C)C)C/C=C(/CCC=C(C)C)C |
| InChI | 1S/C23H38O/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(6)24/h11,13,15,17H,7-10,12,14,16,18H2,1-6H3/b20-13+,21-15+,22-17+ |
| InChIKey | HUCXKZBETONXFO-NJFMWZAGSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.2±24.0°C at 760 mmHg (Cal.) |
| Flash point | 168.0±9.8°C (Cal.) |
| (1) | Robert Huenerbein, Birgitta Schirmer, Jonas Moellmann and Stefan Grimme. Effects of London dispersion on the isomerization reactions of large organic molecules: a density functional benchmark study, Phys. Chem. Chem. Phys., 2010, 12, 6940. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (5E,9E,13E)-6,10,14,18-Tetramethylnonadeca-5,9,13,17-Tetraen-2-One |