|
CAS#: 38024-60-1 Product: 1,3,5-Triethyl-5-Phenyl-1,3-Diazinane-2,4,6-Trione No suppilers available for the product. |
| Name | 1,3,5-Triethyl-5-Phenyl-1,3-Diazinane-2,4,6-Trione |
|---|---|
| Synonyms | 1,3,5-Triethyl-5-Phenyl-Hexahydropyrimidine-2,4,6-Trione; 1,3,5-Triethyl-5-Phenylhexahydropyrimidine-2,4,6-Trione; 1,3,5-Triethyl-5-Phenyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 |
| CAS Registry Number | 38024-60-1 |
| SMILES | C1=CC=C(C=C1)C2(C(=O)N(C(=O)N(C2=O)CC)CC)CC |
| InChI | 1S/C16H20N2O3/c1-4-16(12-10-8-7-9-11-12)13(19)17(5-2)15(21)18(6-3)14(16)20/h7-11H,4-6H2,1-3H3 |
| InChIKey | UGVJFCFVDRFHFP-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.871°C at 760 mmHg (Cal.) |
| Flash point | 160.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Triethyl-5-Phenyl-1,3-Diazinane-2,4,6-Trione |