|
CAS#: 38044-68-7 Product: (9,9-Dimethylacridin-10-Yl)-(2-Dimethylaminoethylsulfanyl)Methanone Ethanesulfonic Acid No suppilers available for the product. |
| Name | (9,9-Dimethylacridin-10-Yl)-(2-Dimethylaminoethylsulfanyl)Methanone Ethanesulfonic Acid |
|---|---|
| Synonyms | 9,9-Dimethyl-10-Acridinecarbothioic Acid S-(2-Dimethylaminoethyl) Ester; Ethanesulfonic Acid; 9,9-Dimethylacridine-10-Carbothioic Acid S-(2-Dimethylaminoethyl) Ester; Ethanesulfonic Acid; Nsc306963 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30N2O4S2 |
| Molecular Weight | 450.61 |
| CAS Registry Number | 38044-68-7 |
| SMILES | C1=CC=CC2=C1C(C3=C(N2C(SCCN(C)C)=O)C=CC=C3)(C)C.C([S](=O)(=O)O)C |
| InChI | 1S/C20H24N2OS.C2H6O3S/c1-20(2)15-9-5-7-11-17(15)22(18-12-8-6-10-16(18)20)19(23)24-14-13-21(3)4;1-2-6(3,4)5/h5-12H,13-14H2,1-4H3;2H2,1H3,(H,3,4,5) |
| InChIKey | MAKMEJFMDVCROW-UHFFFAOYSA-N |
| Boiling point | 450.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 226.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (9,9-Dimethylacridin-10-Yl)-(2-Dimethylaminoethylsulfanyl)Methanone Ethanesulfonic Acid |