|
CAS#: 38115-54-7 Product: 2-[4-(2-Chloroethyl-Methylamino)-2-Methylphenyl]Diazenylbenzoic Acid No suppilers available for the product. |
| Name | 2-[4-(2-Chloroethyl-Methylamino)-2-Methylphenyl]Diazenylbenzoic Acid |
|---|---|
| Synonyms | 2-[4-(2-Chloroethyl-Methyl-Amino)-2-Methyl-Phenyl]Azobenzoic Acid; 2-[4-(2-Chloroethyl-Methylamino)-2-Methylphenyl]Azobenzoic Acid; 2-[4-(2-Chloroethyl-Methyl-Amino)-2-Methyl-Phenyl]Diazenylbenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 |
| CAS Registry Number | 38115-54-7 |
| SMILES | C1=C(N(CCCl)C)C=C(C(=C1)N=NC2=C(C(=O)O)C=CC=C2)C |
| InChI | 1S/C17H18ClN3O2/c1-12-11-13(21(2)10-9-18)7-8-15(12)19-20-16-6-4-3-5-14(16)17(22)23/h3-8,11H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | FONSTHKLWINFKT-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.785°C at 760 mmHg (Cal.) |
| Flash point | 286.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(2-Chloroethyl-Methylamino)-2-Methylphenyl]Diazenylbenzoic Acid |