|
CAS#: 38139-94-5 Product: 2-Methyl-2-Propenamide polymer with 1-ethenyl-2-pyrrolidone No suppilers available for the product. |
| Name | 2-Methyl-2-Propenamide polymer with 1-ethenyl-2-pyrrolidone |
|---|---|
| Synonyms | 2-Methylprop-2-Enamide; 1-Vinylpyrrolidin-2-One; 2-Methylprop-2-Enamide; 1-Vinyl-2-Pyrrolidinone; Methacrylamide; 1-Vinyl-2-Pyrrolidone |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 38139-94-5 |
| SMILES | O=C1N(CCC1)C=C.CC(C(=O)N)=C |
| InChI | 1S/C6H9NO.C4H7NO/c1-2-7-5-3-4-6(7)8;1-3(2)4(5)6/h2H,1,3-5H2;1H2,2H3,(H2,5,6) |
| InChIKey | SEYNHYBXSWRXRX-UHFFFAOYSA-N |
| Boiling point | 217.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 93.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propenamide polymer with 1-ethenyl-2-pyrrolidone |