Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Cyclopenta[3,4]Pyrrolo[1,2-a]Benzimidazole |
|---|---|
| Synonyms | benzo[d]cyclopenta[3,4]pyrrolo[1,2-a]imidazole |
| Molecular Structure | ![CAS#: 38143-40-7, Cyclopenta[3,4]Pyrrolo[1,2-a]Benzimidazole](/moreStructures/38143-40-7.gif) |
| Molecular Formula | C13H8N2 |
| Molecular Weight | 192.22 |
| CAS Registry Number | 38143-40-7 |
| SMILES | C1=CC=C2C(=C1)N=C3N2C=C4C3=CC=C4 |
| InChI | 1S/C13H8N2/c1-2-7-12-11(6-1)14-13-10-5-3-4-9(10)8-15(12)13/h1-8H |
| InChIKey | JEPIDYPHPHRPDC-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.3±28.0°C at 760 mmHg (Cal.) |
| Flash point | 254.0±24.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclopenta[3,4]Pyrrolo[1,2-a]Benzimidazole |