|
CAS#: 38178-41-5 Product: 2-Nitrooxanthrene No suppilers available for the product. |
| Name | 2-Nitrooxanthrene |
|---|---|
| Synonyms | Zinc02007870; 2-Nitro-Dibenzo-P-Dioxin; 2-Nitrodibenzo-4-Dioxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7NO4 |
| Molecular Weight | 229.19 |
| CAS Registry Number | 38178-41-5 |
| SMILES | C1=C2C(=CC=C1[N+](=O)[O-])OC3=C(O2)C=CC=C3 |
| InChI | 1S/C12H7NO4/c14-13(15)8-5-6-11-12(7-8)17-10-4-2-1-3-9(10)16-11/h1-7H |
| InChIKey | PBIXRFKWYPNCAB-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.514°C at 760 mmHg (Cal.) |
| Flash point | 172.875°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitrooxanthrene |