|
CAS#: 38218-87-0 Product: Copper(1+) Sodium 2-(Carboxymethyl)-2-Hydroxysuccinate (1:1:1) No suppilers available for the product. |
| Name | Copper(1+) Sodium 2-(Carboxymethyl)-2-Hydroxysuccinate (1:1:1) |
|---|---|
| Synonyms | citric acid, copper sodium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6CuNaO7 |
| Molecular Weight | 276.64 |
| CAS Registry Number | 38218-87-0 |
| EINECS | 253-831-8 |
| SMILES | [Cu+].[Na+].O=C([O-])CC(O)(CC(=O)O)C([O-])=O |
| InChI | 1S/C6H8O7.Cu.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | OFFXOAFOXHNZRU-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Copper(1+) Sodium 2-(Carboxymethyl)-2-Hydroxysuccinate (1:1:1) |