|
CAS#: 38226-53-8 Product: 1-(Naphthalen-2-Ylsulfinylmethyl)Cyclohexan-1-Ol No suppilers available for the product. |
| Name | 1-(Naphthalen-2-Ylsulfinylmethyl)Cyclohexan-1-Ol |
|---|---|
| Synonyms | 1-(2-Naphthylsulfinylmethyl)Cyclohexan-1-Ol; 1-(2-Naphthylsulfinylmethyl)-1-Cyclohexanol; 1-((2-Naphthylsulfinyl)Methyl)Cyclohexanol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.40 |
| CAS Registry Number | 38226-53-8 |
| SMILES | C1=C3C(=CC=C1[S](CC2(CCCCC2)O)=O)C=CC=C3 |
| InChI | 1S/C17H20O2S/c18-17(10-4-1-5-11-17)13-20(19)16-9-8-14-6-2-3-7-15(14)12-16/h2-3,6-9,12,18H,1,4-5,10-11,13H2 |
| InChIKey | FTVDJXULJFVIKQ-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.239°C at 760 mmHg (Cal.) |
| Flash point | 262.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Naphthalen-2-Ylsulfinylmethyl)Cyclohexan-1-Ol |