|
CAS#: 38241-21-3 Product: 1-Nitroso-4-[(E)-2-Phenylethenyl]Benzene No suppilers available for the product. |
| Name | 1-Nitroso-4-[(E)-2-Phenylethenyl]Benzene |
|---|---|
| Synonyms | 1-Nitroso-4-[(E)-2-Phenylvinyl]Benzene; 4-Nitroso-Trans-Stilbene; 4-Nitrosostilbene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 |
| CAS Registry Number | 38241-21-3 |
| SMILES | C1=C(C=CC(=C1)N=O)\C=C\C2=CC=CC=C2 |
| InChI | 1S/C14H11NO/c16-15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11H/b7-6+ |
| InChIKey | BMPJOHFBCOZGEI-VOTSOKGWSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.481°C at 760 mmHg (Cal.) |
| Flash point | 146.388°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitroso-4-[(E)-2-Phenylethenyl]Benzene |