|
CAS#: 38279-20-8 Product: Di(Phenyl)Methyl Phenyl Carbonate No suppilers available for the product. |
| Name | Di(Phenyl)Methyl Phenyl Carbonate |
|---|---|
| Synonyms | Carbonic Acid Di(Phenyl)Methyl Phenyl Ester; Carbonic Acid, Diphenylmethyl Phenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 |
| CAS Registry Number | 38279-20-8 |
| SMILES | C1=CC=C(C=C1)OC(=O)OC(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C20H16O3/c21-20(22-18-14-8-3-9-15-18)23-19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19H |
| InChIKey | WGGLZAMARBZMKN-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.471°C at 760 mmHg (Cal.) |
| Flash point | 158.462°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(Phenyl)Methyl Phenyl Carbonate |