|
CAS#: 38284-38-7 Product: 4-(Bicyclo[2.2.1]Hept-5-En-2-Yl)-3-Methyl-3-Buten-2-One No suppilers available for the product. |
| Name | 4-(Bicyclo[2.2.1]Hept-5-En-2-Yl)-3-Methyl-3-Buten-2-One |
|---|---|
| Synonyms | 4-bicyclo[2.2.1]hept-5-en-2-yl-3-methyl-3-buten-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.25 |
| CAS Registry Number | 38284-38-7 |
| EINECS | 253-860-6 |
| SMILES | CC(=O)C(C)=CC2CC1/C=C\C2C1 |
| InChI | 1S/C12H16O/c1-8(9(2)13)5-12-7-10-3-4-11(12)6-10/h3-5,10-12H,6-7H2,1-2H3 |
| InChIKey | MSRRPNTUWGQZMN-UHFFFAOYSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.854°C at 760 mmHg (Cal.) |
| Flash point | 117.922°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Bicyclo[2.2.1]Hept-5-En-2-Yl)-3-Methyl-3-Buten-2-One |