|
CAS#: 38331-02-1 Product: 1-(2,4-Dichlorophenyl)Ethenyl Diethyl Phosphate No suppilers available for the product. |
| Name | 1-(2,4-Dichlorophenyl)Ethenyl Diethyl Phosphate |
|---|---|
| Synonyms | 1-(2,4-Dichlorophenyl)Vinyl Diethyl Phosphate; Phosphoric Acid 1-(2,4-Dichlorophenyl)Vinyl Diethyl Ester; Ipo 135 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15Cl2O4P |
| Molecular Weight | 325.13 |
| CAS Registry Number | 38331-02-1 |
| SMILES | C1=C(C(O[P](OCC)(OCC)=O)=C)C(=CC(=C1)Cl)Cl |
| InChI | 1S/C12H15Cl2O4P/c1-4-16-19(15,17-5-2)18-9(3)11-7-6-10(13)8-12(11)14/h6-8H,3-5H2,1-2H3 |
| InChIKey | IZLGBMLXOOGJMU-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.761°C at 760 mmHg (Cal.) |
| Flash point | 282.429°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dichlorophenyl)Ethenyl Diethyl Phosphate |