|
CAS#: 38418-10-9 Product: (4-Methylphenyl)Methyl Benzoate No suppilers available for the product. |
| Name | (4-Methylphenyl)Methyl Benzoate |
|---|---|
| Synonyms | Benzoic Acid (4-Methylphenyl)Methyl Ester; Benzoic Acid (4-Methylbenzyl) Ester; 4-Methylbenzyl Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 38418-10-9 |
| EINECS | 253-921-7 |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2=CC=C(C=C2)C |
| InChI | 1S/C15H14O2/c1-12-7-9-13(10-8-12)11-17-15(16)14-5-3-2-4-6-14/h2-10H,11H2,1H3 |
| InChIKey | VHSYVZKRJCCJMK-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.425°C at 760 mmHg (Cal.) |
| Flash point | 152.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Methylphenyl)Methyl Benzoate |