|
CAS#: 3850-62-2 Product: 4-Methoxy-1-Phenylbicyclo[2.2.2]Octan-2-One No suppilers available for the product. |
| Name | 4-Methoxy-1-Phenylbicyclo[2.2.2]Octan-2-One |
|---|---|
| Synonyms | 4-Methoxy-1-phenylbicyclo[2.2.2]octan-2-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.30 |
| CAS Registry Number | 3850-62-2 |
| SMILES | O=C1CC3(OC)CCC1(c2ccccc2)CC3 |
| InChI | 1S/C15H18O2/c1-17-14-7-9-15(10-8-14,13(16)11-14)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3 |
| InChIKey | FWWRCVAKQXSYQQ-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.916°C at 760 mmHg (Cal.) |
| Flash point | 146.093°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-1-Phenylbicyclo[2.2.2]Octan-2-One |