|
CAS#: 38521-49-2 Product: 1,2,3,4,5-Pentabromo-6-(Phenylmethoxy)Benzene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentabromo-6-(Phenylmethoxy)Benzene |
|---|---|
| Synonyms | 1-(Benzyloxy)-2,3,4,5,6-Pentabromo-Benzene; Benzene, Pentabromo(Phenylmethoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7Br5O |
| Molecular Weight | 578.72 |
| CAS Registry Number | 38521-49-2 |
| EINECS | 253-984-0 |
| SMILES | C1=CC=CC=C1COC2=C(C(=C(Br)C(=C2Br)Br)Br)Br |
| InChI | 1S/C13H7Br5O/c14-8-9(15)11(17)13(12(18)10(8)16)19-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | SMSGVBSSPGZMES-UHFFFAOYSA-N |
| Density | 2.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.879°C at 760 mmHg (Cal.) |
| Flash point | 204.339°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentabromo-6-(Phenylmethoxy)Benzene |