|
CAS#: 38588-66-8 Product: 1,2-Di(Propan-2-Yl)Guanidine Hydrochloride No suppilers available for the product. |
| Name | 1,2-Di(Propan-2-Yl)Guanidine Hydrochloride |
|---|---|
| Synonyms | 1,2-Diisopropylguanidine Hydrochloride; Diisopropylguanidine Hydrochloride; Guanidine, N,N'-Bis(1-Methylethyl)-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H18ClN3 |
| Molecular Weight | 179.69 |
| CAS Registry Number | 38588-66-8 |
| SMILES | [H+].CC(NC(=NC(C)C)N)C.[Cl-] |
| InChI | 1S/C7H17N3.ClH/c1-5(2)9-7(8)10-6(3)4;/h5-6H,1-4H3,(H3,8,9,10);1H |
| InChIKey | ILQWVRZLVLNQAE-UHFFFAOYSA-N |
| Boiling point | 210.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 81.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Di(Propan-2-Yl)Guanidine Hydrochloride |