|
CAS#: 38593-84-9 Product: O-Butyl S-(1-Phenyl-1H-Tetrazol-5-Yl) Carbonothioate No suppilers available for the product. |
| Name | O-Butyl S-(1-Phenyl-1H-Tetrazol-5-Yl) Carbonothioate |
|---|---|
| Synonyms | O-butyl S-(1-phenyl-1H-tetrazol-5-yl) thiocarbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.33 |
| CAS Registry Number | 38593-84-9 |
| EINECS | 254-026-4 |
| SMILES | CCCCOC(=O)Sc2nnnn2c1ccccc1 |
| InChI | 1S/C12H14N4O2S/c1-2-3-9-18-12(17)19-11-13-14-15-16(11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | ZFQUQWYGBQONND-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.947°C at 760 mmHg (Cal.) |
| Flash point | 216.243°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Butyl S-(1-Phenyl-1H-Tetrazol-5-Yl) Carbonothioate |