|
CAS#: 38660-45-6 Product: Potassium (9E,12E,15E)-Octadeca-9,12,15-Trienoate No suppilers available for the product. |
| Name | Potassium (9E,12E,15E)-Octadeca-9,12,15-Trienoate |
|---|---|
| Synonyms | Potassium (9Z,12Z,15Z)-9,12,15-Octadecatrienoate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H29KO2 |
| Molecular Weight | 316.52 |
| CAS Registry Number | 38660-45-6 |
| EINECS | 254-068-3 |
| SMILES | C(C(=O)[O-])CCCCCC\C=C\C\C=C\C\C=C\CC.[K+] |
| InChI | 1S/C18H30O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b4-3+,7-6+,10-9+; |
| InChIKey | FKEDIMSDTKPZNV-ICUOVBAUSA-M |
| Boiling point | 443.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 275.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium (9E,12E,15E)-Octadeca-9,12,15-Trienoate |