|
CAS#: 38701-07-4 Product: Ethyl 2-Methyl-4-Phenyl-2,3-Hexadienoate No suppilers available for the product. |
| Name | Ethyl 2-Methyl-4-Phenyl-2,3-Hexadienoate |
|---|---|
| Synonyms | Ethyl 2-methyl-4-phenyl-2,3-hexadienoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.30 |
| CAS Registry Number | 38701-07-4 |
| SMILES | O=C(OCC)/C(=C=C(/c1ccccc1)CC)C |
| InChI | 1S/C15H18O2/c1-4-13(14-9-7-6-8-10-14)11-12(3)15(16)17-5-2/h6-10H,4-5H2,1-3H3 |
| InChIKey | SLXIMBUCQDAIKA-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.753°C at 760 mmHg (Cal.) |
| Flash point | 205.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Methyl-4-Phenyl-2,3-Hexadienoate |