|
CAS#: 38731-84-9 Product: 2,4-Dimethyl-9H-Xanthene No suppilers available for the product. |
| Name | 2,4-Dimethyl-9H-Xanthene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 38731-84-9 |
| EINECS | 254-109-5 |
| SMILES | C1=C(C=C(C2=C1CC3=C(O2)C=CC=C3)C)C |
| InChI | 1S/C15H14O/c1-10-7-11(2)15-13(8-10)9-12-5-3-4-6-14(12)16-15/h3-8H,9H2,1-2H3 |
| InChIKey | DYPXUDSNLBBKIG-UHFFFAOYSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.712°C at 760 mmHg (Cal.) |
| Flash point | 157.113°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-9H-Xanthene |