|
CAS#: 38776-87-3 Product: N-(2-Chloroethyl)-N-Methyl-9H-Fluoren-9-Amine No suppilers available for the product. |
| Name | N-(2-Chloroethyl)-N-Methyl-9H-Fluoren-9-Amine |
|---|---|
| Synonyms | 2-Chloroethyl-(9H-Fluoren-9-Yl)-Methyl-Amine; Sk&F 550; Skf 550 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 |
| CAS Registry Number | 38776-87-3 |
| SMILES | C1=CC=CC2=C1C(N(C)CCCl)C3=CC=CC=C23 |
| InChI | 1S/C16H16ClN/c1-18(11-10-17)16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16H,10-11H2,1H3 |
| InChIKey | NERVJFDGDIPHLJ-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.019°C at 760 mmHg (Cal.) |
| Flash point | 173.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chloroethyl)-N-Methyl-9H-Fluoren-9-Amine |