|
CAS#: 3883-12-3 Product: Dihydropseudocodeine No suppilers available for the product. |
| Name | Dihydropseudocodeine |
|---|---|
| Synonyms | Morphinan-8-Beta-Ol, 4,5-Alpha-Epoxy-3-Methoxy-17-Methyl-; Pseudocodeine, Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.38 |
| CAS Registry Number | 3883-12-3 |
| SMILES | [C@@H]2(O)[C@H]1[C@H]5CC4=C3[C@]1([C@H](CC2)OC3=C(C=C4)OC)CCN5C |
| InChI | 1S/C18H23NO3/c1-19-8-7-18-14-6-4-12(20)16(18)11(19)9-10-3-5-13(21-2)17(22-14)15(10)18/h3,5,11-12,14,16,20H,4,6-9H2,1-2H3/t11-,12+,14+,16-,18-/m1/s1 |
| InChIKey | QDERMCWKZCSKSY-CVXFFHBFSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.322°C at 760 mmHg (Cal.) |
| Flash point | 239.452°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydropseudocodeine |