|
CAS#: 38842-15-8 Product: N-(Pentafluorobenzyl)-2-Phenylethanamine No suppilers available for the product. |
| Name | N-(Pentafluorobenzyl)-2-Phenylethanamine |
|---|---|
| Synonyms | N-(2,3,4,5,6-Pentafluorobenzyl)-2-phenylethanamine # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12F5N |
| Molecular Weight | 301.25 |
| CAS Registry Number | 38842-15-8 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)CNCCc2ccccc2 |
| InChI | 1S/C15H12F5N/c16-11-10(12(17)14(19)15(20)13(11)18)8-21-7-6-9-4-2-1-3-5-9/h1-5,21H,6-8H2 |
| InChIKey | CIZBCQKQQZUUNK-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.36°C at 760 mmHg (Cal.) |
| Flash point | 145.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Pentafluorobenzyl)-2-Phenylethanamine |